C32H49O6P — CID 175483047
3-[3,5-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl-hydroxyphosphoryl]oxyphenyl]propanoic acid (PubChem CID 175483047) has the molecular formula C32H49O6P and a molecular weight of 560.71 g/mol. Its IUPAC name is 3-[3,5-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl-hydroxyphosphoryl]oxyphenyl]propanoic acid.
| Compound Name | 3-[3,5-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl-hydroxyphosphoryl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 175483047 |
| Molecular Formula | C32H49O6P |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 3-[3,5-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl-hydroxyphosphoryl]oxyphenyl]propanoic acid |
| SMILES | CC(C)(C)c1cc(CP(=O)(O)Oc2c(C(C)(C)C)cc(CCC(=O)O)cc2C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H49O6P/c1-29(2,3)22-17-21(18-23(27(22)35)30(4,5)6)19-39(36,37)38-28-24(31(7,8)9)15-20(13-14-26(33)34)16-25(28)32(10,11)12/h15-18,35H,13-14,19H2,1-12H3,(H,33,34)(H,36,37) |
| InChIKey | BNNIOSYQPYROBQ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|