C38H62O8 — CID 87433847
bis(3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid);2-ethoxyethanol (PubChem CID 87433847) has the molecular formula C38H62O8 and a molecular weight of 646.91 g/mol. Its IUPAC name is bis(3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid);2-ethoxyethanol.
| Compound Name | bis(3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid);2-ethoxyethanol |
|---|---|
| PubChem CID | 87433847 |
| Molecular Formula | C38H62O8 |
| Molecular Weight | 646.91 g/mol |
| Exact Mass | 646.44 |
| IUPAC Name | bis(3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid);2-ethoxyethanol |
| SMILES | CC(C)(C)c1cc(CCC(=O)O)cc(C(C)(C)C)c1O.CC(C)(C)c1cc(CCC(=O)O)cc(C(C)(C)C)c1O.CCOCCO |
| InChI | InChI=1S/2C17H26O3.C4H10O2/c2*1-16(2,3)12-9-11(7-8-14(18)19)10-13(15(12)20)17(4,5)6;1-2-6-4-3-5/h2*9-10,20H,7-8H2,1-6H3,(H,18,19);5H,2-4H2,1H3 |
| InChIKey | NJSZPVQPMLBWTB-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.91 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|