C21H28O3 — CID 5239155
4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]benzene-1,2-diol (PubChem CID 5239155) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]benzene-1,2-diol.
| Compound Name | 4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 5239155 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]benzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(Cc2ccc(O)c(O)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H28O3/c1-20(2,3)15-10-14(11-16(19(15)24)21(4,5)6)9-13-7-8-17(22)18(23)12-13/h7-8,10-12,22-24H,9H2,1-6H3 |
| InChIKey | LPHPULUIFWHEFN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'tert_butyl_B(1)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|