C22H27O4- — CID 54720840
2-carboxy-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenolate (PubChem CID 54720840) has the molecular formula C22H27O4- and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-carboxy-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenolate.
| Compound Name | 2-carboxy-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenolate |
|---|---|
| PubChem CID | 54720840 |
| Molecular Formula | C22H27O4- |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-carboxy-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenolate |
| SMILES | CC(C)(C)c1cc(Cc2ccc([O-])c(C(=O)O)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H28O4/c1-21(2,3)16-11-14(12-17(19(16)24)22(4,5)6)9-13-7-8-18(23)15(10-13)20(25)26/h7-8,10-12,23-24H,9H2,1-6H3,(H,25,26)/p-1 |
| InChIKey | VYPFILQRNJYPQH-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |