C29H36O — CID 149334289
4-[2-(4-benzylphenyl)ethyl]-2,6-ditert-butylphenol (PubChem CID 149334289) has the molecular formula C29H36O and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-[2-(4-benzylphenyl)ethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[2-(4-benzylphenyl)ethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 149334289 |
| Molecular Formula | C29H36O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 4-[2-(4-benzylphenyl)ethyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CCc2ccc(Cc3ccccc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H36O/c1-28(2,3)25-19-24(20-26(27(25)30)29(4,5)6)17-14-21-12-15-23(16-13-21)18-22-10-8-7-9-11-22/h7-13,15-16,19-20,30H,14,17-18H2,1-6H3 |
| InChIKey | YCXSQWURCRNTEH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |