C30H40NO+ — CID 7444512
benzyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-(2-phenylethyl)azanium (PubChem CID 7444512) has the molecular formula C30H40NO+ and a molecular weight of 430.66 g/mol. Its IUPAC name is benzyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-(2-phenylethyl)azanium.
| Compound Name | benzyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 7444512 |
| Molecular Formula | C30H40NO+ |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | benzyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-(2-phenylethyl)azanium |
| SMILES | CC(C)(C)c1cc(C[NH+](CCc2ccccc2)Cc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H39NO/c1-29(2,3)26-19-25(20-27(28(26)32)30(4,5)6)22-31(21-24-15-11-8-12-16-24)18-17-23-13-9-7-10-14-23/h7-16,19-20,32H,17-18,21-22H2,1-6H3/p+1 |
| InChIKey | UHHUAHDGMDLXJH-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |