C48H58O4 — CID 154019174
3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-[10-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]anthracen-9-yl]propan-1-one (PubChem CID 154019174) has the molecular formula C48H58O4 and a molecular weight of 698.99 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-[10-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]anthracen-9-yl]propan-1-one.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-[10-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]anthracen-9-yl]propan-1-one |
|---|---|
| PubChem CID | 154019174 |
| Molecular Formula | C48H58O4 |
| Molecular Weight | 698.99 g/mol |
| Exact Mass | 698.43 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-[10-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]anthracen-9-yl]propan-1-one |
| SMILES | CC(C)(C)c1cc(CCC(=O)c2c3ccccc3c(C(=O)CCc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c3ccccc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C48H58O4/c1-45(2,3)35-25-29(26-36(43(35)51)46(4,5)6)21-23-39(49)41-31-17-13-15-19-33(31)42(34-20-16-14-18-32(34)41)40(50)24-22-30-27-37(47(7,8)9)44(52)38(28-30)48(10,11)12/h13-20,25-28,51-52H,21-24H2,1-12H3 |
| InChIKey | PVPYZEUALUKWRM-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.99 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|