C30H34O2 — CID 161013823
3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(9H-fluoren-1-yl)propan-1-one (PubChem CID 161013823) has the molecular formula C30H34O2 and a molecular weight of 426.60 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(9H-fluoren-1-yl)propan-1-one.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(9H-fluoren-1-yl)propan-1-one |
|---|---|
| PubChem CID | 161013823 |
| Molecular Formula | C30H34O2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(9H-fluoren-1-yl)propan-1-one |
| SMILES | CC(C)(C)c1cc(CCC(=O)c2cccc3c2Cc2ccccc2-3)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H34O2/c1-29(2,3)25-16-19(17-26(28(25)32)30(4,5)6)14-15-27(31)23-13-9-12-22-21-11-8-7-10-20(21)18-24(22)23/h7-13,16-17,32H,14-15,18H2,1-6H3 |
| InChIKey | TXLRVDNPKYZVRB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |