C27H39NO2S — CID 19909148
5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hydroxy-N-(2-phenylethyl)pentanethioamide (PubChem CID 19909148) has the molecular formula C27H39NO2S and a molecular weight of 441.68 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hydroxy-N-(2-phenylethyl)pentanethioamide.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hydroxy-N-(2-phenylethyl)pentanethioamide |
|---|---|
| PubChem CID | 19909148 |
| Molecular Formula | C27H39NO2S |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hydroxy-N-(2-phenylethyl)pentanethioamide |
| SMILES | CC(C)(C)c1cc(CCCCC(=S)N(O)CCc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H39NO2S/c1-26(2,3)22-18-21(19-23(25(22)29)27(4,5)6)14-10-11-15-24(31)28(30)17-16-20-12-8-7-9-13-20/h7-9,12-13,18-19,29-30H,10-11,14-17H2,1-6H3 |
| InChIKey | OHHMKNOEFIEQGZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|