C26H38N2O2S — CID 17132467
1-benzyl-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2-methoxyethyl)thiourea (PubChem CID 17132467) has the molecular formula C26H38N2O2S and a molecular weight of 442.67 g/mol. Its IUPAC name is 1-benzyl-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-benzyl-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 17132467 |
| Molecular Formula | C26H38N2O2S |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 1-benzyl-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)N(Cc1ccccc1)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H38N2O2S/c1-25(2,3)21-15-20(16-22(23(21)29)26(4,5)6)18-28(24(31)27-13-14-30-7)17-19-11-9-8-10-12-19/h8-12,15-16,29H,13-14,17-18H2,1-7H3,(H,27,31) |
| InChIKey | UALSNMBQWLYXOY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|