C17H21N3OS — CID 3294970
1-benzyl-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 3294970) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-benzyl-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-benzyl-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3294970 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-benzyl-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | COCCNC(=S)N(Cc1ccccc1)Cc1ccncc1 |
| InChI | InChI=1S/C17H21N3OS/c1-21-12-11-19-17(22)20(13-15-5-3-2-4-6-15)14-16-7-9-18-10-8-16/h2-10H,11-14H2,1H3,(H,19,22) |
| InChIKey | GLLRXLZRNNDAIZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|