C19H23N3OS — CID 40572590
1-benzyl-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 40572590) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-benzyl-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-benzyl-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 40572590 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-benzyl-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)N(Cc1ccccc1)Cc1ccncc1 |
| InChI | InChI=1S/C19H23N3OS/c24-19(21-13-18-7-4-12-23-18)22(14-16-5-2-1-3-6-16)15-17-8-10-20-11-9-17/h1-3,5-6,8-11,18H,4,7,12-15H2,(H,21,24)/t18-/m0/s1 |
| InChIKey | HRFSGGRDVGNXGP-SFHVURJKSA-N |
| XLogP | 3.14 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|