C12H17ClN2O3 — CID 66997327
[(2S)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)carbamic acid;hydrochloride (PubChem CID 66997327) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)carbamic acid;hydrochloride.
| Compound Name | [(2S)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 66997327 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)carbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)N(Cc1ccncc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H16N2O3.ClH/c15-12(16)14(9-11-2-1-7-17-11)8-10-3-5-13-6-4-10;/h3-6,11H,1-2,7-9H2,(H,15,16);1H/t11-;/m0./s1 |
| InChIKey | YQOWHRXHYJEXRV-MERQFXBCSA-N |
| XLogP | 2.16 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |