C23H29N3O3 — CID 52520502
1,1-bis[[(2R)-oxolan-2-yl]methyl]-3-[4-(pyridin-4-ylmethyl)phenyl]urea (PubChem CID 52520502) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1,1-bis[[(2R)-oxolan-2-yl]methyl]-3-[4-(pyridin-4-ylmethyl)phenyl]urea.
| Compound Name | 1,1-bis[[(2R)-oxolan-2-yl]methyl]-3-[4-(pyridin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 52520502 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1,1-bis[[(2R)-oxolan-2-yl]methyl]-3-[4-(pyridin-4-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cc2ccncc2)cc1)N(C[C@H]1CCCO1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H29N3O3/c27-23(26(16-21-3-1-13-28-21)17-22-4-2-14-29-22)25-20-7-5-18(6-8-20)15-19-9-11-24-12-10-19/h5-12,21-22H,1-4,13-17H2,(H,25,27)/t21-,22-/m1/s1 |
| InChIKey | FOKNGFNSEVCHOM-FGZHOGPDSA-N |
| XLogP | 3.86 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |