C24H28FN3O4 — CID 47051038
3-[bis(oxolan-2-ylmethyl)carbamoylamino]-N-(3-fluorophenyl)benzamide (PubChem CID 47051038) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is 3-[bis(oxolan-2-ylmethyl)carbamoylamino]-N-(3-fluorophenyl)benzamide.
| Compound Name | 3-[bis(oxolan-2-ylmethyl)carbamoylamino]-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 47051038 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 3-[bis(oxolan-2-ylmethyl)carbamoylamino]-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cccc(NC(=O)N(CC2CCCO2)CC2CCCO2)c1 |
| InChI | InChI=1S/C24H28FN3O4/c25-18-6-2-8-20(14-18)26-23(29)17-5-1-7-19(13-17)27-24(30)28(15-21-9-3-11-31-21)16-22-10-4-12-32-22/h1-2,5-8,13-14,21-22H,3-4,9-12,15-16H2,(H,26,29)(H,27,30) |
| InChIKey | SAXMCIKAEDXLJO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |