C19H27FN2O3 — CID 51952632
3-[bis[[(2R)-oxolan-2-yl]methyl]amino]-N-(3-fluorophenyl)propanamide (PubChem CID 51952632) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is 3-[bis[[(2R)-oxolan-2-yl]methyl]amino]-N-(3-fluorophenyl)propanamide.
| Compound Name | 3-[bis[[(2R)-oxolan-2-yl]methyl]amino]-N-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 51952632 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-[bis[[(2R)-oxolan-2-yl]methyl]amino]-N-(3-fluorophenyl)propanamide |
| SMILES | O=C(CCN(C[C@H]1CCCO1)C[C@H]1CCCO1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN2O3/c20-15-4-1-5-16(12-15)21-19(23)8-9-22(13-17-6-2-10-24-17)14-18-7-3-11-25-18/h1,4-5,12,17-18H,2-3,6-11,13-14H2,(H,21,23)/t17-,18-/m1/s1 |
| InChIKey | JGUPKDXCEBBLMT-QZTJIDSGSA-N |
| XLogP | 2.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |