C26H34FN3O3 — CID 93128767
N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 93128767) has the molecular formula C26H34FN3O3 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 93128767 |
| Molecular Formula | C26H34FN3O3 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(F)c2)cc1CN(C[C@H]1CCCO1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C26H34FN3O3/c1-26(2,3)25(32)30(17-22-10-7-13-33-22)16-19-15-21(11-12-23(19)29(4)5)28-24(31)18-8-6-9-20(27)14-18/h6,8-9,11-12,14-15,22H,7,10,13,16-17H2,1-5H3,(H,28,31)/t22-/m1/s1 |
| InChIKey | VTNCZMYKGOUXTK-JOCHJYFZSA-N |
| XLogP | 4.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|