C27H30F2N4O2 — CID 42817286
N-[4-(dimethylamino)-3-[[2-(dimethylamino)ethyl-(4-fluorobenzoyl)amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 42817286) has the molecular formula C27H30F2N4O2 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[2-(dimethylamino)ethyl-(4-fluorobenzoyl)amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-(dimethylamino)-3-[[2-(dimethylamino)ethyl-(4-fluorobenzoyl)amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 42817286 |
| Molecular Formula | C27H30F2N4O2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[2-(dimethylamino)ethyl-(4-fluorobenzoyl)amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | CN(C)CCN(Cc1cc(NC(=O)c2cccc(F)c2)ccc1N(C)C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H30F2N4O2/c1-31(2)14-15-33(27(35)19-8-10-22(28)11-9-19)18-21-17-24(12-13-25(21)32(3)4)30-26(34)20-6-5-7-23(29)16-20/h5-13,16-17H,14-15,18H2,1-4H3,(H,30,34) |
| InChIKey | KVZYWKIYBYPXGX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|