C28H31F2N3O2 — CID 93128624
N-[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-[(2R)-3-methylbutan-2-yl]amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 93128624) has the molecular formula C28H31F2N3O2 and a molecular weight of 479.57 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-[(2R)-3-methylbutan-2-yl]amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-[(2R)-3-methylbutan-2-yl]amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 93128624 |
| Molecular Formula | C28H31F2N3O2 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-[(2R)-3-methylbutan-2-yl]amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | CC(C)[C@@H](C)N(Cc1cc(NC(=O)c2cccc(F)c2)ccc1N(C)C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H31F2N3O2/c1-18(2)19(3)33(28(35)20-9-11-23(29)12-10-20)17-22-16-25(13-14-26(22)32(4)5)31-27(34)21-7-6-8-24(30)15-21/h6-16,18-19H,17H2,1-5H3,(H,31,34)/t19-/m1/s1 |
| InChIKey | ZTTRLMUNDKIRSP-LJQANCHMSA-N |
| XLogP | 5.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|