C24H34FN5O2 — CID 46138517
1-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-3-(3-fluorophenyl)-1-(3-methylbutan-2-yl)urea (PubChem CID 46138517) has the molecular formula C24H34FN5O2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-3-(3-fluorophenyl)-1-(3-methylbutan-2-yl)urea.
| Compound Name | 1-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-3-(3-fluorophenyl)-1-(3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 46138517 |
| Molecular Formula | C24H34FN5O2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 1-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-3-(3-fluorophenyl)-1-(3-methylbutan-2-yl)urea |
| SMILES | CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)Nc2cccc(F)c2)C(C)C(C)C)c1 |
| InChI | InChI=1S/C24H34FN5O2/c1-7-26-23(31)27-21-11-12-22(29(5)6)18(13-21)15-30(17(4)16(2)3)24(32)28-20-10-8-9-19(25)14-20/h8-14,16-17H,7,15H2,1-6H3,(H,28,32)(H2,26,27,31) |
| InChIKey | JMHJGAGNVSJCGE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|