C25H35FN4O2 — CID 93129082
N-[3-[[[(2R)-butan-2-yl]-[(3-fluorophenyl)carbamoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide (PubChem CID 93129082) has the molecular formula C25H35FN4O2 and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[3-[[[(2R)-butan-2-yl]-[(3-fluorophenyl)carbamoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[[(2R)-butan-2-yl]-[(3-fluorophenyl)carbamoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 93129082 |
| Molecular Formula | C25H35FN4O2 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N-[3-[[[(2R)-butan-2-yl]-[(3-fluorophenyl)carbamoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide |
| SMILES | CC[C@@H](C)N(Cc1cc(NC(=O)CC(C)C)ccc1N(C)C)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C25H35FN4O2/c1-7-18(4)30(25(32)28-21-10-8-9-20(26)15-21)16-19-14-22(11-12-23(19)29(5)6)27-24(31)13-17(2)3/h8-12,14-15,17-18H,7,13,16H2,1-6H3,(H,27,31)(H,28,32)/t18-/m1/s1 |
| InChIKey | COMVRVFRCGJVRM-GOSISDBHSA-N |
| XLogP | 5.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|