C21H36N4O2 — CID 42669755
N-butan-2-yl-N-[[2-(dimethylamino)-5-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-methylpropanamide (PubChem CID 42669755) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N-butan-2-yl-N-[[2-(dimethylamino)-5-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-butan-2-yl-N-[[2-(dimethylamino)-5-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42669755 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | N-butan-2-yl-N-[[2-(dimethylamino)-5-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-methylpropanamide |
| SMILES | CCC(C)N(Cc1cc(NC(=O)NC(C)C)ccc1N(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C21H36N4O2/c1-9-16(6)25(20(26)14(2)3)13-17-12-18(10-11-19(17)24(7)8)23-21(27)22-15(4)5/h10-12,14-16H,9,13H2,1-8H3,(H2,22,23,27) |
| InChIKey | TULVYLIHMDHGTE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|