C30H36FN3O2 — CID 93128420
N-[4-(dimethylamino)-3-[[2-ethylbutanoyl-[(1S)-1-phenylethyl]amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 93128420) has the molecular formula C30H36FN3O2 and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[2-ethylbutanoyl-[(1S)-1-phenylethyl]amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-(dimethylamino)-3-[[2-ethylbutanoyl-[(1S)-1-phenylethyl]amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 93128420 |
| Molecular Formula | C30H36FN3O2 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[2-ethylbutanoyl-[(1S)-1-phenylethyl]amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | CCC(CC)C(=O)N(Cc1cc(NC(=O)c2cccc(F)c2)ccc1N(C)C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C30H36FN3O2/c1-6-22(7-2)30(36)34(21(3)23-12-9-8-10-13-23)20-25-19-27(16-17-28(25)33(4)5)32-29(35)24-14-11-15-26(31)18-24/h8-19,21-22H,6-7,20H2,1-5H3,(H,32,35)/t21-/m0/s1 |
| InChIKey | PEIVXNXEUBROSA-NRFANRHFSA-N |
| XLogP | 6.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|