C23H33N3O — CID 42815492
N-[[5-amino-2-(dimethylamino)phenyl]methyl]-2-ethyl-N-(1-phenylethyl)butanamide (PubChem CID 42815492) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is N-[[5-amino-2-(dimethylamino)phenyl]methyl]-2-ethyl-N-(1-phenylethyl)butanamide.
| Compound Name | N-[[5-amino-2-(dimethylamino)phenyl]methyl]-2-ethyl-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 42815492 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | N-[[5-amino-2-(dimethylamino)phenyl]methyl]-2-ethyl-N-(1-phenylethyl)butanamide |
| SMILES | CCC(CC)C(=O)N(Cc1cc(N)ccc1N(C)C)C(C)c1ccccc1 |
| InChI | InChI=1S/C23H33N3O/c1-6-18(7-2)23(27)26(17(3)19-11-9-8-10-12-19)16-20-15-21(24)13-14-22(20)25(4)5/h8-15,17-18H,6-7,16,24H2,1-5H3 |
| InChIKey | XMYJKQZZZASHBO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|