C20H25FN4O2 — CID 42747819
2-(dimethylamino)-N,N-diethyl-5-[(3-fluorophenyl)carbamoylamino]benzamide (PubChem CID 42747819) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-(dimethylamino)-N,N-diethyl-5-[(3-fluorophenyl)carbamoylamino]benzamide.
| Compound Name | 2-(dimethylamino)-N,N-diethyl-5-[(3-fluorophenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42747819 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-(dimethylamino)-N,N-diethyl-5-[(3-fluorophenyl)carbamoylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2cccc(F)c2)ccc1N(C)C |
| InChI | InChI=1S/C20H25FN4O2/c1-5-25(6-2)19(26)17-13-16(10-11-18(17)24(3)4)23-20(27)22-15-9-7-8-14(21)12-15/h7-13H,5-6H2,1-4H3,(H2,22,23,27) |
| InChIKey | LEMDJHUCVLBNMG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|