C16H24ClN3O2 — CID 771591
5-[[(2S)-2-chloropropanoyl]amino]-2-(dimethylamino)-N,N-diethylbenzamide (PubChem CID 771591) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 5-[[(2S)-2-chloropropanoyl]amino]-2-(dimethylamino)-N,N-diethylbenzamide.
| Compound Name | 5-[[(2S)-2-chloropropanoyl]amino]-2-(dimethylamino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 771591 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 5-[[(2S)-2-chloropropanoyl]amino]-2-(dimethylamino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)[C@H](C)Cl)ccc1N(C)C |
| InChI | InChI=1S/C16H24ClN3O2/c1-6-20(7-2)16(22)13-10-12(18-15(21)11(3)17)8-9-14(13)19(4)5/h8-11H,6-7H2,1-5H3,(H,18,21)/t11-/m0/s1 |
| InChIKey | VAQRUFXARKZBMI-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|