C26H29N3O2 — CID 7125440
2-(dimethylamino)-N,N-diethyl-5-[(4-phenylbenzoyl)amino]benzamide (PubChem CID 7125440) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-(dimethylamino)-N,N-diethyl-5-[(4-phenylbenzoyl)amino]benzamide.
| Compound Name | 2-(dimethylamino)-N,N-diethyl-5-[(4-phenylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 7125440 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-(dimethylamino)-N,N-diethyl-5-[(4-phenylbenzoyl)amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccc(-c3ccccc3)cc2)ccc1N(C)C |
| InChI | InChI=1S/C26H29N3O2/c1-5-29(6-2)26(31)23-18-22(16-17-24(23)28(3)4)27-25(30)21-14-12-20(13-15-21)19-10-8-7-9-11-19/h7-18H,5-6H2,1-4H3,(H,27,30) |
| InChIKey | AMTUFJSPKXWQTG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|