C29H35N3O2 — CID 5177723
N-benzyl-2-(dimethylamino)-5-[(4-hexylbenzoyl)amino]benzamide (PubChem CID 5177723) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-benzyl-2-(dimethylamino)-5-[(4-hexylbenzoyl)amino]benzamide.
| Compound Name | N-benzyl-2-(dimethylamino)-5-[(4-hexylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 5177723 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-benzyl-2-(dimethylamino)-5-[(4-hexylbenzoyl)amino]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2ccc(N(C)C)c(C(=O)NCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H35N3O2/c1-4-5-6-8-11-22-14-16-24(17-15-22)28(33)31-25-18-19-27(32(2)3)26(20-25)29(34)30-21-23-12-9-7-10-13-23/h7,9-10,12-20H,4-6,8,11,21H2,1-3H3,(H,30,34)(H,31,33) |
| InChIKey | PVDVHXQHMZACSP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|