C16H23Cl2N3O3 — CID 4551644
5-[(2,2-dichloroacetyl)amino]-2-(dimethylamino)-N-(3-ethoxypropyl)benzamide (PubChem CID 4551644) has the molecular formula C16H23Cl2N3O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is 5-[(2,2-dichloroacetyl)amino]-2-(dimethylamino)-N-(3-ethoxypropyl)benzamide.
| Compound Name | 5-[(2,2-dichloroacetyl)amino]-2-(dimethylamino)-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 4551644 |
| Molecular Formula | C16H23Cl2N3O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 5-[(2,2-dichloroacetyl)amino]-2-(dimethylamino)-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)C(Cl)Cl)ccc1N(C)C |
| InChI | InChI=1S/C16H23Cl2N3O3/c1-4-24-9-5-8-19-15(22)12-10-11(20-16(23)14(17)18)6-7-13(12)21(2)3/h6-7,10,14H,4-5,8-9H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | KWWKSGPPWQEHEB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|