C21H32ClN3O3 — CID 7306724
5-[[(2R)-2-chloropropanoyl]amino]-N-(3-ethoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 7306724) has the molecular formula C21H32ClN3O3 and a molecular weight of 409.96 g/mol. Its IUPAC name is 5-[[(2R)-2-chloropropanoyl]amino]-N-(3-ethoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[[(2R)-2-chloropropanoyl]amino]-N-(3-ethoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 7306724 |
| Molecular Formula | C21H32ClN3O3 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 5-[[(2R)-2-chloropropanoyl]amino]-N-(3-ethoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)[C@@H](C)Cl)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C21H32ClN3O3/c1-4-28-13-5-10-23-21(27)18-14-17(24-20(26)16(3)22)6-7-19(18)25-11-8-15(2)9-12-25/h6-7,14-16H,4-5,8-13H2,1-3H3,(H,23,27)(H,24,26)/t16-/m1/s1 |
| InChIKey | AKQFNNMMWGKATC-MRXNPFEDSA-N |
| XLogP | 3.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|