C23H36N4O5 — CID 3470484
ethyl 2-[[3-(3-ethoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]carbamoylamino]acetate (PubChem CID 3470484) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethyl 2-[[3-(3-ethoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-(3-ethoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 3470484 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | ethyl 2-[[3-(3-ethoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]carbamoylamino]acetate |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)NCC(=O)OCC)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C23H36N4O5/c1-4-31-14-6-11-24-22(29)19-15-18(26-23(30)25-16-21(28)32-5-2)7-8-20(19)27-12-9-17(3)10-13-27/h7-8,15,17H,4-6,9-14,16H2,1-3H3,(H,24,29)(H2,25,26,30) |
| InChIKey | ZUCIKIKBIQKMAR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|