C25H34N4O3 — CID 3883990
5-[(2,6-dimethylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 3883990) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3883990 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)Nc2c(C)cccc2C)ccc1N1CCCC1 |
| InChI | InChI=1S/C25H34N4O3/c1-4-32-16-8-13-26-24(30)21-17-20(11-12-22(21)29-14-5-6-15-29)27-25(31)28-23-18(2)9-7-10-19(23)3/h7,9-12,17H,4-6,8,13-16H2,1-3H3,(H,26,30)(H2,27,28,31) |
| InChIKey | HBNDHEMDPDEQSI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|