C27H38N4O3 — CID 3992320
N-(3-ethoxypropyl)-2-piperidin-1-yl-5-[(4-propan-2-ylphenyl)carbamoylamino]benzamide (PubChem CID 3992320) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-piperidin-1-yl-5-[(4-propan-2-ylphenyl)carbamoylamino]benzamide.
| Compound Name | N-(3-ethoxypropyl)-2-piperidin-1-yl-5-[(4-propan-2-ylphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 3992320 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-(3-ethoxypropyl)-2-piperidin-1-yl-5-[(4-propan-2-ylphenyl)carbamoylamino]benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)Nc2ccc(C(C)C)cc2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C27H38N4O3/c1-4-34-18-8-15-28-26(32)24-19-23(13-14-25(24)31-16-6-5-7-17-31)30-27(33)29-22-11-9-21(10-12-22)20(2)3/h9-14,19-20H,4-8,15-18H2,1-3H3,(H,28,32)(H2,29,30,33) |
| InChIKey | QFPBVDGYHIITAQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|