C21H32ClN3O3 — CID 3579642
5-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 3579642) has the molecular formula C21H32ClN3O3 and a molecular weight of 409.96 g/mol. Its IUPAC name is 5-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3579642 |
| Molecular Formula | C21H32ClN3O3 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 5-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-(3-ethoxypropyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)C(C)(C)CCl)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H32ClN3O3/c1-4-28-13-7-10-23-19(26)17-14-16(24-20(27)21(2,3)15-22)8-9-18(17)25-11-5-6-12-25/h8-9,14H,4-7,10-13,15H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | CWINABYLQNYWIF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|