C25H41N3O3 — CID 5037032
N-(3-ethoxypropyl)-5-(nonanoylamino)-2-pyrrolidin-1-ylbenzamide (PubChem CID 5037032) has the molecular formula C25H41N3O3 and a molecular weight of 431.62 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-(nonanoylamino)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(3-ethoxypropyl)-5-(nonanoylamino)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 5037032 |
| Molecular Formula | C25H41N3O3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | N-(3-ethoxypropyl)-5-(nonanoylamino)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCCCCCCCC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCCCOCC)c1 |
| InChI | InChI=1S/C25H41N3O3/c1-3-5-6-7-8-9-13-24(29)27-21-14-15-23(28-17-10-11-18-28)22(20-21)25(30)26-16-12-19-31-4-2/h14-15,20H,3-13,16-19H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | VNSKKJUIAYZNJI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|