C24H31FN4O4 — CID 46111240
ethyl 2-[[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-propylamino]methyl]phenyl]carbamoylamino]acetate (PubChem CID 46111240) has the molecular formula C24H31FN4O4 and a molecular weight of 458.53 g/mol. Its IUPAC name is ethyl 2-[[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-propylamino]methyl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-propylamino]methyl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 46111240 |
| Molecular Formula | C24H31FN4O4 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | ethyl 2-[[4-(dimethylamino)-3-[[(4-fluorobenzoyl)-propylamino]methyl]phenyl]carbamoylamino]acetate |
| SMILES | CCCN(Cc1cc(NC(=O)NCC(=O)OCC)ccc1N(C)C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FN4O4/c1-5-13-29(23(31)17-7-9-19(25)10-8-17)16-18-14-20(11-12-21(18)28(3)4)27-24(32)26-15-22(30)33-6-2/h7-12,14H,5-6,13,15-16H2,1-4H3,(H2,26,27,32) |
| InChIKey | AGDOBUQCTWXACQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|