C20H33N3O3 — CID 42816419
N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-2,2-dimethyl-N-propylpropanamide (PubChem CID 42816419) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-2,2-dimethyl-N-propylpropanamide.
| Compound Name | N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-2,2-dimethyl-N-propylpropanamide |
|---|---|
| PubChem CID | 42816419 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-2,2-dimethyl-N-propylpropanamide |
| SMILES | CCCN(Cc1cc(NC(=O)COC)ccc1N(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C20H33N3O3/c1-8-11-23(19(25)20(2,3)4)13-15-12-16(21-18(24)14-26-7)9-10-17(15)22(5)6/h9-10,12H,8,11,13-14H2,1-7H3,(H,21,24) |
| InChIKey | ZDFNZZDPHNCKQG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|