C19H30ClN3O2 — CID 56540193
N-[3-chloro-4-(dimethylamino)phenyl]-N',N'-dipropylpentanediamide (PubChem CID 56540193) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56540193 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)Nc1ccc(N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C19H30ClN3O2/c1-5-12-23(13-6-2)19(25)9-7-8-18(24)21-15-10-11-17(22(3)4)16(20)14-15/h10-11,14H,5-9,12-13H2,1-4H3,(H,21,24) |
| InChIKey | VJCLBJLMPVALHJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|