C16H26N4O2 — CID 119516549
N-(6-amino-3-pyridinyl)-N',N'-dipropylpentanediamide (PubChem CID 119516549) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-N',N'-dipropylpentanediamide.
| Compound Name | N-(6-amino-3-pyridinyl)-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 119516549 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C16H26N4O2/c1-3-10-20(11-4-2)16(22)7-5-6-15(21)19-13-8-9-14(17)18-12-13/h8-9,12H,3-7,10-11H2,1-2H3,(H2,17,18)(H,19,21) |
| InChIKey | YRTZEKZJHYQOFZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |