C14H22ClN3O — CID 119516594
N-(6-amino-3-pyridinyl)-4-cyclopentylbutanamide;hydrochloride (PubChem CID 119516594) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-4-cyclopentylbutanamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-4-cyclopentylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119516594 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-4-cyclopentylbutanamide;hydrochloride |
| SMILES | Cl.Nc1ccc(NC(=O)CCCC2CCCC2)cn1 |
| InChI | InChI=1S/C14H21N3O.ClH/c15-13-9-8-12(10-16-13)17-14(18)7-3-6-11-4-1-2-5-11;/h8-11H,1-7H2,(H2,15,16)(H,17,18);1H |
| InChIKey | GOMHGTANOLNZMZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |