C15H24ClN3O — CID 119515073
N-(6-amino-3-pyridinyl)-2-(cyclopentylmethyl)butanamide;hydrochloride (PubChem CID 119515073) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-(cyclopentylmethyl)butanamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-2-(cyclopentylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119515073 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-(cyclopentylmethyl)butanamide;hydrochloride |
| SMILES | CCC(CC1CCCC1)C(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C15H23N3O.ClH/c1-2-12(9-11-5-3-4-6-11)15(19)18-13-7-8-14(16)17-10-13;/h7-8,10-12H,2-6,9H2,1H3,(H2,16,17)(H,18,19);1H |
| InChIKey | PHCQQQBGLMBZTA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |