C14H23ClN4O2 — CID 119515259
N-(6-amino-3-pyridinyl)-N',N'-diethylpentanediamide;hydrochloride (PubChem CID 119515259) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-N',N'-diethylpentanediamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-N',N'-diethylpentanediamide;hydrochloride |
|---|---|
| PubChem CID | 119515259 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-N',N'-diethylpentanediamide;hydrochloride |
| SMILES | CCN(CC)C(=O)CCCC(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C14H22N4O2.ClH/c1-3-18(4-2)14(20)7-5-6-13(19)17-11-8-9-12(15)16-10-11;/h8-10H,3-7H2,1-2H3,(H2,15,16)(H,17,19);1H |
| InChIKey | RHZLIZKSGKUIAZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |