C21H30N2O4 — CID 171556867
N-[4-(3,5-dioxohexyl)phenyl]-N',N'-diethylpentanediamide (PubChem CID 171556867) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[4-(3,5-dioxohexyl)phenyl]-N',N'-diethylpentanediamide.
| Compound Name | N-[4-(3,5-dioxohexyl)phenyl]-N',N'-diethylpentanediamide |
|---|---|
| PubChem CID | 171556867 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[4-(3,5-dioxohexyl)phenyl]-N',N'-diethylpentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)Nc1ccc(CCC(=O)CC(C)=O)cc1 |
| InChI | InChI=1S/C21H30N2O4/c1-4-23(5-2)21(27)8-6-7-20(26)22-18-12-9-17(10-13-18)11-14-19(25)15-16(3)24/h9-10,12-13H,4-8,11,14-15H2,1-3H3,(H,22,26) |
| InChIKey | GYDOXWAAUMNDPE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|