C22H31NO4 — CID 58078857
N-[4-(3,5-dioxohexyl)phenyl]-7,7-dimethyl-5-oxooctanamide (PubChem CID 58078857) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is N-[4-(3,5-dioxohexyl)phenyl]-7,7-dimethyl-5-oxooctanamide.
| Compound Name | N-[4-(3,5-dioxohexyl)phenyl]-7,7-dimethyl-5-oxooctanamide |
|---|---|
| PubChem CID | 58078857 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N-[4-(3,5-dioxohexyl)phenyl]-7,7-dimethyl-5-oxooctanamide |
| SMILES | CC(=O)CC(=O)CCc1ccc(NC(=O)CCCC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31NO4/c1-16(24)14-19(25)13-10-17-8-11-18(12-9-17)23-21(27)7-5-6-20(26)15-22(2,3)4/h8-9,11-12H,5-7,10,13-15H2,1-4H3,(H,23,27) |
| InChIKey | UHLDFVUDRUCPPH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|