C15H21IO — CID 164972566
1-(4-iodophenyl)-6,6-dimethylheptan-4-one (PubChem CID 164972566) has the molecular formula C15H21IO and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-(4-iodophenyl)-6,6-dimethylheptan-4-one.
| Compound Name | 1-(4-iodophenyl)-6,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 164972566 |
| Molecular Formula | C15H21IO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-(4-iodophenyl)-6,6-dimethylheptan-4-one |
| SMILES | CC(C)(C)CC(=O)CCCc1ccc(I)cc1 |
| InChI | InChI=1S/C15H21IO/c1-15(2,3)11-14(17)6-4-5-12-7-9-13(16)10-8-12/h7-10H,4-6,11H2,1-3H3 |
| InChIKey | DIDZODAQEGYKRJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|