C14H19IS — CID 134309816
6-(4-iodophenyl)-2,2-dimethylhexane-3-thione (PubChem CID 134309816) has the molecular formula C14H19IS and a molecular weight of 346.28 g/mol. Its IUPAC name is 6-(4-iodophenyl)-2,2-dimethylhexane-3-thione.
| Compound Name | 6-(4-iodophenyl)-2,2-dimethylhexane-3-thione |
|---|---|
| PubChem CID | 134309816 |
| Molecular Formula | C14H19IS |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 6-(4-iodophenyl)-2,2-dimethylhexane-3-thione |
| SMILES | CC(C)(C)C(=S)CCCc1ccc(I)cc1 |
| InChI | InChI=1S/C14H19IS/c1-14(2,3)13(16)6-4-5-11-7-9-12(15)10-8-11/h7-10H,4-6H2,1-3H3 |
| InChIKey | XPVHXVJOABDTJV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|