C20H31IN2O3 — CID 175997228
tert-butyl (2S)-2,6-diamino-10-(4-iodophenyl)-7-oxodecanoate (PubChem CID 175997228) has the molecular formula C20H31IN2O3 and a molecular weight of 474.38 g/mol. Its IUPAC name is tert-butyl (2S)-2,6-diamino-10-(4-iodophenyl)-7-oxodecanoate.
| Compound Name | tert-butyl (2S)-2,6-diamino-10-(4-iodophenyl)-7-oxodecanoate |
|---|---|
| PubChem CID | 175997228 |
| Molecular Formula | C20H31IN2O3 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | tert-butyl (2S)-2,6-diamino-10-(4-iodophenyl)-7-oxodecanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)CCCC(N)C(=O)CCCc1ccc(I)cc1 |
| InChI | InChI=1S/C20H31IN2O3/c1-20(2,3)26-19(25)17(23)8-5-7-16(22)18(24)9-4-6-14-10-12-15(21)13-11-14/h10-13,16-17H,4-9,22-23H2,1-3H3/t16?,17-/m0/s1 |
| InChIKey | ILZGLMHXZOOUCA-DJNXLDHESA-N |
| XLogP | 3.35 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|