C17H25NO5 — CID 70088992
3-[4-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]propanoic acid (PubChem CID 70088992) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[4-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70088992 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-[4-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)CCOc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO5/c1-17(2,3)23-16(21)14(18)10-11-22-13-7-4-12(5-8-13)6-9-15(19)20/h4-5,7-8,14H,6,9-11,18H2,1-3H3,(H,19,20) |
| InChIKey | PPLNGSUYRIOPNU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |