C16H24O — CID 105093400
7,7-dimethyl-1-phenyloctan-4-one (PubChem CID 105093400) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 7,7-dimethyl-1-phenyloctan-4-one.
| Compound Name | 7,7-dimethyl-1-phenyloctan-4-one |
|---|---|
| PubChem CID | 105093400 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 7,7-dimethyl-1-phenyloctan-4-one |
| SMILES | CC(C)(C)CCC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C16H24O/c1-16(2,3)13-12-15(17)11-7-10-14-8-5-4-6-9-14/h4-6,8-9H,7,10-13H2,1-3H3 |
| InChIKey | BYDVRVOSCQYRDS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |