C30H47N3O6 — CID 143668136
N'-[1-(6-amino-3-methyl-6-oxohexan-3-yl)oxy-3-methylpentan-3-yl]-N-[4-(3,5-dioxohexyl)phenyl]pentanediamide (PubChem CID 143668136) has the molecular formula C30H47N3O6 and a molecular weight of 545.72 g/mol. Its IUPAC name is N'-[1-(6-amino-3-methyl-6-oxohexan-3-yl)oxy-3-methylpentan-3-yl]-N-[4-(3,5-dioxohexyl)phenyl]pentanediamide.
| Compound Name | N'-[1-(6-amino-3-methyl-6-oxohexan-3-yl)oxy-3-methylpentan-3-yl]-N-[4-(3,5-dioxohexyl)phenyl]pentanediamide |
|---|---|
| PubChem CID | 143668136 |
| Molecular Formula | C30H47N3O6 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | N'-[1-(6-amino-3-methyl-6-oxohexan-3-yl)oxy-3-methylpentan-3-yl]-N-[4-(3,5-dioxohexyl)phenyl]pentanediamide |
| SMILES | CCC(C)(CCOC(C)(CC)CCC(N)=O)NC(=O)CCCC(=O)Nc1ccc(CCC(=O)CC(C)=O)cc1 |
| InChI | InChI=1S/C30H47N3O6/c1-6-29(4,19-20-39-30(5,7-2)18-17-26(31)36)33-28(38)10-8-9-27(37)32-24-14-11-23(12-15-24)13-16-25(35)21-22(3)34/h11-12,14-15H,6-10,13,16-21H2,1-5H3,(H2,31,36)(H,32,37)(H,33,38) |
| InChIKey | JCNCOLHMNAILGT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|